About 3-amino-2-ethylbenzamide;fluorobenzene
3-amino-2-ethylbenzamide;fluorobenzene (PubChem CID 174889008) has the molecular formula C15H17FN2O
and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-amino-2-ethylbenzamide;fluorobenzene.
Molecular Properties
| Compound Name | 3-amino-2-ethylbenzamide;fluorobenzene |
| PubChem CID | 174889008 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-amino-2-ethylbenzamide;fluorobenzene |
| SMILES | CCc1c(N)cccc1C(N)=O.Fc1ccccc1 |
| InChI | InChI=1S/C9H12N2O.C6H5F/c1-2-6-7(9(11)12)4-3-5-8(6)10;7-6-4-2-1-3-5-6/h3-5H,2,10H2,1H3,(H2,11,12);1-5H |
| InChIKey | JXSWTNKFTGBUOE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-ethylbenzamide;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-ethylbenzamide;fluorobenzene?
The IUPAC name of 3-amino-2-ethylbenzamide;fluorobenzene (CID 174889008) is 3-amino-2-ethylbenzamide;fluorobenzene.
What is the SMILES notation for 3-amino-2-ethylbenzamide;fluorobenzene?
The canonical SMILES for 3-amino-2-ethylbenzamide;fluorobenzene is CCc1c(N)cccc1C(N)=O.Fc1ccccc1.
What is the InChIKey of 3-amino-2-ethylbenzamide;fluorobenzene?
The InChIKey is JXSWTNKFTGBUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.C6H5F/c1-2-6-7(9(11)12)4-3-5-8(6)10;7-6-4-2-1-3-5-6/h3-5H,2,10H2,1H3,(H2,11,12);1-5H.
What are the key properties of 3-amino-2-ethylbenzamide;fluorobenzene?
3-amino-2-ethylbenzamide;fluorobenzene has a molecular weight of 260.31 g/mol, XLogP of 2.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-ethylbenzamide;fluorobenzene is sourced from PubChem (CID 174889008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).