About 3-amino-2-ethylbenzoic acid
3-amino-2-ethylbenzoic acid (PubChem CID 18185344) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-amino-2-ethylbenzoic acid.
Molecular Properties
| Compound Name | 3-amino-2-ethylbenzoic acid |
| PubChem CID | 18185344 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-amino-2-ethylbenzoic acid |
| SMILES | CCc1c(N)cccc1C(=O)O |
| InChI | InChI=1S/C9H11NO2/c1-2-6-7(9(11)12)4-3-5-8(6)10/h3-5H,2,10H2,1H3,(H,11,12) |
| InChIKey | UMIIZOBDBBNULH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-ethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-ethylbenzoic acid?
The IUPAC name of 3-amino-2-ethylbenzoic acid (CID 18185344) is 3-amino-2-ethylbenzoic acid.
What is the SMILES notation for 3-amino-2-ethylbenzoic acid?
The canonical SMILES for 3-amino-2-ethylbenzoic acid is CCc1c(N)cccc1C(=O)O.
What is the InChIKey of 3-amino-2-ethylbenzoic acid?
The InChIKey is UMIIZOBDBBNULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-6-7(9(11)12)4-3-5-8(6)10/h3-5H,2,10H2,1H3,(H,11,12).
What are the key properties of 3-amino-2-ethylbenzoic acid?
3-amino-2-ethylbenzoic acid has a molecular weight of 165.19 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-ethylbenzoic acid is sourced from PubChem (CID 18185344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).