About 2-ethyl-3-iodobenzoic acid
2-ethyl-3-iodobenzoic acid (PubChem CID 22121847) has the molecular formula C9H9IO2
and a molecular weight of 276.07 g/mol. Its IUPAC name is 2-ethyl-3-iodobenzoic acid.
Molecular Properties
| Compound Name | 2-ethyl-3-iodobenzoic acid |
| PubChem CID | 22121847 |
| Molecular Formula | C9H9IO2 |
| Molecular Weight | 276.07 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | 2-ethyl-3-iodobenzoic acid |
| SMILES | CCc1c(I)cccc1C(=O)O |
| InChI | InChI=1S/C9H9IO2/c1-2-6-7(9(11)12)4-3-5-8(6)10/h3-5H,2H2,1H3,(H,11,12) |
| InChIKey | OYJAWGFBSIJECU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.07 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-iodobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-iodobenzoic acid?
The IUPAC name of 2-ethyl-3-iodobenzoic acid (CID 22121847) is 2-ethyl-3-iodobenzoic acid.
What is the SMILES notation for 2-ethyl-3-iodobenzoic acid?
The canonical SMILES for 2-ethyl-3-iodobenzoic acid is CCc1c(I)cccc1C(=O)O.
What is the InChIKey of 2-ethyl-3-iodobenzoic acid?
The InChIKey is OYJAWGFBSIJECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO2/c1-2-6-7(9(11)12)4-3-5-8(6)10/h3-5H,2H2,1H3,(H,11,12).
What are the key properties of 2-ethyl-3-iodobenzoic acid?
2-ethyl-3-iodobenzoic acid has a molecular weight of 276.07 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-iodobenzoic acid is sourced from PubChem (CID 22121847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).