About 3-ethenyl-2-ethylbenzoic acid
3-ethenyl-2-ethylbenzoic acid (PubChem CID 70289721) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 3-ethenyl-2-ethylbenzoic acid.
Molecular Properties
| Compound Name | 3-ethenyl-2-ethylbenzoic acid |
| PubChem CID | 70289721 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 3-ethenyl-2-ethylbenzoic acid |
| SMILES | C=Cc1cccc(C(=O)O)c1CC |
| InChI | InChI=1S/C11H12O2/c1-3-8-6-5-7-10(11(12)13)9(8)4-2/h3,5-7H,1,4H2,2H3,(H,12,13) |
| InChIKey | NLSQFBGWDIZMFW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-2-ethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2-ethylbenzoic acid?
The IUPAC name of 3-ethenyl-2-ethylbenzoic acid (CID 70289721) is 3-ethenyl-2-ethylbenzoic acid.
What is the SMILES notation for 3-ethenyl-2-ethylbenzoic acid?
The canonical SMILES for 3-ethenyl-2-ethylbenzoic acid is C=Cc1cccc(C(=O)O)c1CC.
What is the InChIKey of 3-ethenyl-2-ethylbenzoic acid?
The InChIKey is NLSQFBGWDIZMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-3-8-6-5-7-10(11(12)13)9(8)4-2/h3,5-7H,1,4H2,2H3,(H,12,13).
What are the key properties of 3-ethenyl-2-ethylbenzoic acid?
3-ethenyl-2-ethylbenzoic acid has a molecular weight of 176.21 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2-ethylbenzoic acid is sourced from PubChem (CID 70289721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).