2-ethenylbenzene-1,3-dicarboxylic acid

C10H8O4 — CID 141248980

IUPAC2-ethenylbenzene-1,3-dicarboxylic acid
SMILESC=Cc1c(C(=O)O)cccc1C(=O)O
InChIInChI=1S/C10H8O4/c1-2-6-7(9(11)12)4-3-5-8(6)10(13)14/h2-5H,1H2,(H,11,12)(H,13,14)
InChIKeyMTTSLAZUMLLDGZ-UHFFFAOYSA-N
MW192.17 g/mol
LogP1.73
Rot. Bonds3

About 2-ethenylbenzene-1,3-dicarboxylic acid

2-ethenylbenzene-1,3-dicarboxylic acid (PubChem CID 141248980) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-ethenylbenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-ethenylbenzene-1,3-dicarboxylic acid
PubChem CID141248980
Molecular FormulaC10H8O4
Molecular Weight192.17 g/mol
Exact Mass192.04
IUPAC Name2-ethenylbenzene-1,3-dicarboxylic acid
SMILESC=Cc1c(C(=O)O)cccc1C(=O)O
InChIInChI=1S/C10H8O4/c1-2-6-7(9(11)12)4-3-5-8(6)10(13)14/h2-5H,1H2,(H,11,12)(H,13,14)
InChIKeyMTTSLAZUMLLDGZ-UHFFFAOYSA-N
XLogP1.73
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-ethenylbenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethenylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 2-ethenylbenzene-1,3-dicarboxylic acid (CID 141248980) is 2-ethenylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-ethenylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 2-ethenylbenzene-1,3-dicarboxylic acid is C=Cc1c(C(=O)O)cccc1C(=O)O.
What is the InChIKey of 2-ethenylbenzene-1,3-dicarboxylic acid?
The InChIKey is MTTSLAZUMLLDGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4/c1-2-6-7(9(11)12)4-3-5-8(6)10(13)14/h2-5H,1H2,(H,11,12)(H,13,14).
What are the key properties of 2-ethenylbenzene-1,3-dicarboxylic acid?
2-ethenylbenzene-1,3-dicarboxylic acid has a molecular weight of 192.17 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 141248980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).