C21H24 — CID 173010088
1,3-bis(ethenyl)-2-ethylbenzene;prop-1-en-2-ylbenzene (PubChem CID 173010088) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,3-bis(ethenyl)-2-ethylbenzene;prop-1-en-2-ylbenzene.
| Compound Name | 1,3-bis(ethenyl)-2-ethylbenzene;prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 173010088 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 1,3-bis(ethenyl)-2-ethylbenzene;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.C=Cc1cccc(C=C)c1CC |
| InChI | InChI=1S/C12H14.C9H10/c1-4-10-8-7-9-11(5-2)12(10)6-3;1-8(2)9-6-4-3-5-7-9/h4-5,7-9H,1-2,6H2,3H3;3-7H,1H2,2H3 |
| InChIKey | OQCDCGRMVZYGJZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |