C19H22 — CID 159036970
1-ethenyl-4-ethylbenzene;prop-1-en-2-ylbenzene (PubChem CID 159036970) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-ethenyl-4-ethylbenzene;prop-1-en-2-ylbenzene.
| Compound Name | 1-ethenyl-4-ethylbenzene;prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 159036970 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-ethenyl-4-ethylbenzene;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.C=Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C10H12.C9H10/c1-3-9-5-7-10(4-2)8-6-9;1-8(2)9-6-4-3-5-7-9/h3,5-8H,1,4H2,2H3;3-7H,1H2,2H3 |
| InChIKey | JVOQNJAJPQANBA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |