About prop-1-en-2-ylbenzene;silane
prop-1-en-2-ylbenzene;silane (PubChem CID 174724970) has the molecular formula C9H14Si
and a molecular weight of 150.30 g/mol. Its IUPAC name is prop-1-en-2-ylbenzene;silane.
Molecular Properties
| Compound Name | prop-1-en-2-ylbenzene;silane |
| PubChem CID | 174724970 |
| Molecular Formula | C9H14Si |
| Molecular Weight | 150.30 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | prop-1-en-2-ylbenzene;silane |
| SMILES | C=C(C)c1ccccc1.[SiH4] |
| InChI | InChI=1S/C9H10.H4Si/c1-8(2)9-6-4-3-5-7-9;/h3-7H,1H2,2H3;1H4 |
| InChIKey | USHKQGBYLPDOAH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-ylbenzene;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-ylbenzene;silane?
The IUPAC name of prop-1-en-2-ylbenzene;silane (CID 174724970) is prop-1-en-2-ylbenzene;silane.
What is the SMILES notation for prop-1-en-2-ylbenzene;silane?
The canonical SMILES for prop-1-en-2-ylbenzene;silane is C=C(C)c1ccccc1.[SiH4].
What is the InChIKey of prop-1-en-2-ylbenzene;silane?
The InChIKey is USHKQGBYLPDOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.H4Si/c1-8(2)9-6-4-3-5-7-9;/h3-7H,1H2,2H3;1H4.
What are the key properties of prop-1-en-2-ylbenzene;silane?
prop-1-en-2-ylbenzene;silane has a molecular weight of 150.30 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-ylbenzene;silane is sourced from PubChem (CID 174724970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).