C11H16O2 — CID 68647860
ethane-1,2-diol;prop-1-en-2-ylbenzene (PubChem CID 68647860) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is ethane-1,2-diol;prop-1-en-2-ylbenzene.
| Compound Name | ethane-1,2-diol;prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 68647860 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | ethane-1,2-diol;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.OCCO |
| InChI | InChI=1S/C9H10.C2H6O2/c1-8(2)9-6-4-3-5-7-9;3-1-2-4/h3-7H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | VFYFIEYFVXIKLJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |