About methylimino(oxo)methane;prop-1-en-2-ylbenzene
methylimino(oxo)methane;prop-1-en-2-ylbenzene (PubChem CID 157367451) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is methylimino(oxo)methane;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | methylimino(oxo)methane;prop-1-en-2-ylbenzene |
| PubChem CID | 157367451 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | methylimino(oxo)methane;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.CN=C=O |
| InChI | InChI=1S/C9H10.C2H3NO/c1-8(2)9-6-4-3-5-7-9;1-3-2-4/h3-7H,1H2,2H3;1H3 |
| InChIKey | BJIXWCDUJSMGGU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze methylimino(oxo)methane;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylimino(oxo)methane;prop-1-en-2-ylbenzene?
The IUPAC name of methylimino(oxo)methane;prop-1-en-2-ylbenzene (CID 157367451) is methylimino(oxo)methane;prop-1-en-2-ylbenzene.
What is the SMILES notation for methylimino(oxo)methane;prop-1-en-2-ylbenzene?
The canonical SMILES for methylimino(oxo)methane;prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.CN=C=O.
What is the InChIKey of methylimino(oxo)methane;prop-1-en-2-ylbenzene?
The InChIKey is BJIXWCDUJSMGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C2H3NO/c1-8(2)9-6-4-3-5-7-9;1-3-2-4/h3-7H,1H2,2H3;1H3.
What are the key properties of methylimino(oxo)methane;prop-1-en-2-ylbenzene?
methylimino(oxo)methane;prop-1-en-2-ylbenzene has a molecular weight of 175.23 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylimino(oxo)methane;prop-1-en-2-ylbenzene is sourced from PubChem (CID 157367451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).