About calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene
calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene (PubChem CID 174823812) has the molecular formula C13H12CaO4
and a molecular weight of 272.31 g/mol. Its IUPAC name is calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene |
| PubChem CID | 174823812 |
| Molecular Formula | C13H12CaO4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.O=C([O-])/C=C\C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C9H10.C4H4O4.Ca/c1-8(2)9-6-4-3-5-7-9;5-3(6)1-2-4(7)8;/h3-7H,1H2,2H3;1-2H,(H,5,6)(H,7,8);/q;;+2/p-2/b;2-1-; |
| InChIKey | DBSFQMHJWRYMFC-FJOGWHKWSA-L |
| XLogP | -0.62 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene?
The IUPAC name of calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene (CID 174823812) is calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene.
What is the SMILES notation for calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene?
The canonical SMILES for calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.O=C([O-])/C=C\C(=O)[O-].[Ca+2].
What is the InChIKey of calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene?
The InChIKey is DBSFQMHJWRYMFC-FJOGWHKWSA-L. The full InChI is InChI=1S/C9H10.C4H4O4.Ca/c1-8(2)9-6-4-3-5-7-9;5-3(6)1-2-4(7)8;/h3-7H,1H2,2H3;1-2H,(H,5,6)(H,7,8);/q;;+2/p-2/b;2-1-;.
What are the key properties of calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene?
calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene has a molecular weight of 272.31 g/mol, XLogP of -0.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;(Z)-but-2-enedioate;prop-1-en-2-ylbenzene is sourced from PubChem (CID 174823812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).