About methyl prop-2-enoate;prop-1-en-2-ylbenzene
methyl prop-2-enoate;prop-1-en-2-ylbenzene (PubChem CID 18185793) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is methyl prop-2-enoate;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | methyl prop-2-enoate;prop-1-en-2-ylbenzene |
| PubChem CID | 18185793 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | methyl prop-2-enoate;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.C=CC(=O)OC |
| InChI | InChI=1S/C9H10.C4H6O2/c1-8(2)9-6-4-3-5-7-9;1-3-4(5)6-2/h3-7H,1H2,2H3;3H,1H2,2H3 |
| InChIKey | DZRPWOWZACFICG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl prop-2-enoate;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl prop-2-enoate;prop-1-en-2-ylbenzene?
The IUPAC name of methyl prop-2-enoate;prop-1-en-2-ylbenzene (CID 18185793) is methyl prop-2-enoate;prop-1-en-2-ylbenzene.
What is the SMILES notation for methyl prop-2-enoate;prop-1-en-2-ylbenzene?
The canonical SMILES for methyl prop-2-enoate;prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.C=CC(=O)OC.
What is the InChIKey of methyl prop-2-enoate;prop-1-en-2-ylbenzene?
The InChIKey is DZRPWOWZACFICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C4H6O2/c1-8(2)9-6-4-3-5-7-9;1-3-4(5)6-2/h3-7H,1H2,2H3;3H,1H2,2H3.
What are the key properties of methyl prop-2-enoate;prop-1-en-2-ylbenzene?
methyl prop-2-enoate;prop-1-en-2-ylbenzene has a molecular weight of 204.27 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl prop-2-enoate;prop-1-en-2-ylbenzene is sourced from PubChem (CID 18185793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).