About tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene
tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene (PubChem CID 174427640) has the molecular formula C24H30O2
and a molecular weight of 350.50 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene |
| PubChem CID | 174427640 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene |
| SMILES | C=C(C)c1ccccc1.C=CC(=O)OC(C)(C)C.C=Cc1ccccc1 |
| InChI | InChI=1S/C9H10.C8H8.C7H12O2/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8;1-5-6(8)9-7(2,3)4/h3-7H,1H2,2H3;2-7H,1H2;5H,1H2,2-4H3 |
| InChIKey | DWKWWJZAVIFKOA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene?
The IUPAC name of tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene (CID 174427640) is tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene.
What is the SMILES notation for tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene?
The canonical SMILES for tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene is C=C(C)c1ccccc1.C=CC(=O)OC(C)(C)C.C=Cc1ccccc1.
What is the InChIKey of tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene?
The InChIKey is DWKWWJZAVIFKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C8H8.C7H12O2/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8;1-5-6(8)9-7(2,3)4/h3-7H,1H2,2H3;2-7H,1H2;5H,1H2,2-4H3.
What are the key properties of tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene?
tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene has a molecular weight of 350.50 g/mol, XLogP of 6.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;prop-1-en-2-ylbenzene;styrene is sourced from PubChem (CID 174427640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).