C14H20O2 — CID 144999518
methyl 2,2-dimethylpropanoate;styrene (PubChem CID 144999518) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is methyl 2,2-dimethylpropanoate;styrene.
| Compound Name | methyl 2,2-dimethylpropanoate;styrene |
|---|---|
| PubChem CID | 144999518 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | methyl 2,2-dimethylpropanoate;styrene |
| SMILES | C=Cc1ccccc1.COC(=O)C(C)(C)C |
| InChI | InChI=1S/C8H8.C6H12O2/c1-2-8-6-4-3-5-7-8;1-6(2,3)5(7)8-4/h2-7H,1H2;1-4H3 |
| InChIKey | PFZLGLSVHJCJAD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |