About ethenamine;prop-1-en-2-ylbenzene
ethenamine;prop-1-en-2-ylbenzene (PubChem CID 172805831) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is ethenamine;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | ethenamine;prop-1-en-2-ylbenzene |
| PubChem CID | 172805831 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | ethenamine;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.C=CN |
| InChI | InChI=1S/C9H10.C2H5N/c1-8(2)9-6-4-3-5-7-9;1-2-3/h3-7H,1H2,2H3;2H,1,3H2 |
| InChIKey | RMOCDZAUKUCFQP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethenamine;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenamine;prop-1-en-2-ylbenzene?
The IUPAC name of ethenamine;prop-1-en-2-ylbenzene (CID 172805831) is ethenamine;prop-1-en-2-ylbenzene.
What is the SMILES notation for ethenamine;prop-1-en-2-ylbenzene?
The canonical SMILES for ethenamine;prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.C=CN.
What is the InChIKey of ethenamine;prop-1-en-2-ylbenzene?
The InChIKey is RMOCDZAUKUCFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C2H5N/c1-8(2)9-6-4-3-5-7-9;1-2-3/h3-7H,1H2,2H3;2H,1,3H2.
What are the key properties of ethenamine;prop-1-en-2-ylbenzene?
ethenamine;prop-1-en-2-ylbenzene has a molecular weight of 161.25 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenamine;prop-1-en-2-ylbenzene is sourced from PubChem (CID 172805831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).