About methane;propane;prop-1-en-2-ylbenzene
methane;propane;prop-1-en-2-ylbenzene (PubChem CID 145329923) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is methane;propane;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | methane;propane;prop-1-en-2-ylbenzene |
| PubChem CID | 145329923 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | methane;propane;prop-1-en-2-ylbenzene |
| SMILES | C.C=C(C)c1ccccc1.CCC |
| InChI | InChI=1S/C9H10.C3H8.CH4/c1-8(2)9-6-4-3-5-7-9;1-3-2;/h3-7H,1H2,2H3;3H2,1-2H3;1H4 |
| InChIKey | UJAHWOTYLCVCMD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;propane;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;propane;prop-1-en-2-ylbenzene?
The IUPAC name of methane;propane;prop-1-en-2-ylbenzene (CID 145329923) is methane;propane;prop-1-en-2-ylbenzene.
What is the SMILES notation for methane;propane;prop-1-en-2-ylbenzene?
The canonical SMILES for methane;propane;prop-1-en-2-ylbenzene is C.C=C(C)c1ccccc1.CCC.
What is the InChIKey of methane;propane;prop-1-en-2-ylbenzene?
The InChIKey is UJAHWOTYLCVCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C3H8.CH4/c1-8(2)9-6-4-3-5-7-9;1-3-2;/h3-7H,1H2,2H3;3H2,1-2H3;1H4.
What are the key properties of methane;propane;prop-1-en-2-ylbenzene?
methane;propane;prop-1-en-2-ylbenzene has a molecular weight of 178.32 g/mol, XLogP of 4.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;propane;prop-1-en-2-ylbenzene is sourced from PubChem (CID 145329923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).