C11H10F4 — CID 161134762
prop-1-en-2-ylbenzene;1,1,2,2-tetrafluoroethene (PubChem CID 161134762) has the molecular formula C11H10F4 and a molecular weight of 218.19 g/mol. Its IUPAC name is prop-1-en-2-ylbenzene;1,1,2,2-tetrafluoroethene.
| Compound Name | prop-1-en-2-ylbenzene;1,1,2,2-tetrafluoroethene |
|---|---|
| PubChem CID | 161134762 |
| Molecular Formula | C11H10F4 |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | prop-1-en-2-ylbenzene;1,1,2,2-tetrafluoroethene |
| SMILES | C=C(C)c1ccccc1.FC(F)=C(F)F |
| InChI | InChI=1S/C9H10.C2F4/c1-8(2)9-6-4-3-5-7-9;3-1(4)2(5)6/h3-7H,1H2,2H3; |
| InChIKey | UMQLOAHERPZKFV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |