About ethane;methoxymethane;prop-1-en-2-ylbenzene
ethane;methoxymethane;prop-1-en-2-ylbenzene (PubChem CID 160714954) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;methoxymethane;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | ethane;methoxymethane;prop-1-en-2-ylbenzene |
| PubChem CID | 160714954 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | ethane;methoxymethane;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.CC.COC |
| InChI | InChI=1S/C9H10.C2H6O.C2H6/c1-8(2)9-6-4-3-5-7-9;1-3-2;1-2/h3-7H,1H2,2H3;1-2H3;1-2H3 |
| InChIKey | RSIROSIUUYWZBA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methoxymethane;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxymethane;prop-1-en-2-ylbenzene?
The IUPAC name of ethane;methoxymethane;prop-1-en-2-ylbenzene (CID 160714954) is ethane;methoxymethane;prop-1-en-2-ylbenzene.
What is the SMILES notation for ethane;methoxymethane;prop-1-en-2-ylbenzene?
The canonical SMILES for ethane;methoxymethane;prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.CC.COC.
What is the InChIKey of ethane;methoxymethane;prop-1-en-2-ylbenzene?
The InChIKey is RSIROSIUUYWZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C2H6O.C2H6/c1-8(2)9-6-4-3-5-7-9;1-3-2;1-2/h3-7H,1H2,2H3;1-2H3;1-2H3.
What are the key properties of ethane;methoxymethane;prop-1-en-2-ylbenzene?
ethane;methoxymethane;prop-1-en-2-ylbenzene has a molecular weight of 194.32 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxymethane;prop-1-en-2-ylbenzene is sourced from PubChem (CID 160714954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).