About lithium;butane;prop-1-en-2-ylbenzene
lithium;butane;prop-1-en-2-ylbenzene (PubChem CID 173314205) has the molecular formula C13H19Li
and a molecular weight of 182.24 g/mol. Its IUPAC name is lithium;butane;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | lithium;butane;prop-1-en-2-ylbenzene |
| PubChem CID | 173314205 |
| Molecular Formula | C13H19Li |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.16 |
| IUPAC Name | lithium;butane;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.[CH2-]CCC.[Li+] |
| InChI | InChI=1S/C9H10.C4H9.Li/c1-8(2)9-6-4-3-5-7-9;1-3-4-2;/h3-7H,1H2,2H3;1,3-4H2,2H3;/q;-1;+1 |
| InChIKey | ZCAVBYABPKPELY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;butane;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;butane;prop-1-en-2-ylbenzene?
The IUPAC name of lithium;butane;prop-1-en-2-ylbenzene (CID 173314205) is lithium;butane;prop-1-en-2-ylbenzene.
What is the SMILES notation for lithium;butane;prop-1-en-2-ylbenzene?
The canonical SMILES for lithium;butane;prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.[CH2-]CCC.[Li+].
What is the InChIKey of lithium;butane;prop-1-en-2-ylbenzene?
The InChIKey is ZCAVBYABPKPELY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C4H9.Li/c1-8(2)9-6-4-3-5-7-9;1-3-4-2;/h3-7H,1H2,2H3;1,3-4H2,2H3;/q;-1;+1.
What are the key properties of lithium;butane;prop-1-en-2-ylbenzene?
lithium;butane;prop-1-en-2-ylbenzene has a molecular weight of 182.24 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;butane;prop-1-en-2-ylbenzene is sourced from PubChem (CID 173314205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).