About 3-phenylbut-2-enoate
3-phenylbut-2-enoate (PubChem CID 6995278) has the molecular formula C10H9O2-
and a molecular weight of 161.18 g/mol. Its IUPAC name is 3-phenylbut-2-enoate.
Molecular Properties
| Compound Name | 3-phenylbut-2-enoate |
| PubChem CID | 6995278 |
| Molecular Formula | C10H9O2- |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3-phenylbut-2-enoate |
| SMILES | CC(=CC(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C10H10O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)/p-1 |
| InChIKey | PEXWJYDPDXUVSV-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbut-2-enoate?
The IUPAC name of 3-phenylbut-2-enoate (CID 6995278) is 3-phenylbut-2-enoate.
What is the SMILES notation for 3-phenylbut-2-enoate?
The canonical SMILES for 3-phenylbut-2-enoate is CC(=CC(=O)[O-])c1ccccc1.
What is the InChIKey of 3-phenylbut-2-enoate?
The InChIKey is PEXWJYDPDXUVSV-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)/p-1.
What are the key properties of 3-phenylbut-2-enoate?
3-phenylbut-2-enoate has a molecular weight of 161.18 g/mol, XLogP of 0.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbut-2-enoate is sourced from PubChem (CID 6995278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).