C24H20O — CID 628086
1,3,5-triphenylhexa-2,4-dien-1-one (PubChem CID 628086) has the molecular formula C24H20O and a molecular weight of 324.42 g/mol. Its IUPAC name is 1,3,5-triphenylhexa-2,4-dien-1-one.
| Compound Name | 1,3,5-triphenylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 628086 |
| Molecular Formula | C24H20O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1,3,5-triphenylhexa-2,4-dien-1-one |
| SMILES | CC(=CC(=CC(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20O/c1-19(20-11-5-2-6-12-20)17-23(21-13-7-3-8-14-21)18-24(25)22-15-9-4-10-16-22/h2-18H,1H3 |
| InChIKey | WDSOTYDUTUFIBE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|