C19H17Br — CID 126595609
[(2E,4E)-6-bromo-4-phenylhepta-2,4,6-trien-2-yl]benzene (PubChem CID 126595609) has the molecular formula C19H17Br and a molecular weight of 325.25 g/mol. Its IUPAC name is [(2E,4E)-6-bromo-4-phenylhepta-2,4,6-trien-2-yl]benzene.
| Compound Name | [(2E,4E)-6-bromo-4-phenylhepta-2,4,6-trien-2-yl]benzene |
|---|---|
| PubChem CID | 126595609 |
| Molecular Formula | C19H17Br |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [(2E,4E)-6-bromo-4-phenylhepta-2,4,6-trien-2-yl]benzene |
| SMILES | C=C(Br)/C=C(\C=C(/C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17Br/c1-15(17-9-5-3-6-10-17)13-19(14-16(2)20)18-11-7-4-8-12-18/h3-14H,2H2,1H3/b15-13+,19-14+ |
| InChIKey | HVSWHDYGDYEXKH-OIXOFKMYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|