C22H28 — CID 155701822
ethane;[(2E,4E)-5-ethenyl-6-methylidene-4-prop-1-en-2-ylocta-2,4,7-trien-2-yl]benzene (PubChem CID 155701822) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is ethane;[(2E,4E)-5-ethenyl-6-methylidene-4-prop-1-en-2-ylocta-2,4,7-trien-2-yl]benzene.
| Compound Name | ethane;[(2E,4E)-5-ethenyl-6-methylidene-4-prop-1-en-2-ylocta-2,4,7-trien-2-yl]benzene |
|---|---|
| PubChem CID | 155701822 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | ethane;[(2E,4E)-5-ethenyl-6-methylidene-4-prop-1-en-2-ylocta-2,4,7-trien-2-yl]benzene |
| SMILES | C=CC(=C)C(C=C)=C(/C=C(\C)c1ccccc1)C(=C)C.CC |
| InChI | InChI=1S/C20H22.C2H6/c1-7-16(5)19(8-2)20(15(3)4)14-17(6)18-12-10-9-11-13-18;1-2/h7-14H,1-3,5H2,4,6H3;1-2H3/b17-14+,20-19+; |
| InChIKey | QNDSUFSCPWLIJX-CBTMUZHYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|