C24H22O — CID 145465512
(3Z)-4-methyl-3-[(E)-2-[4-(2-phenylethynyl)phenyl]prop-1-enyl]hexa-3,5-dien-2-one (PubChem CID 145465512) has the molecular formula C24H22O and a molecular weight of 326.44 g/mol. Its IUPAC name is (3Z)-4-methyl-3-[(E)-2-[4-(2-phenylethynyl)phenyl]prop-1-enyl]hexa-3,5-dien-2-one.
| Compound Name | (3Z)-4-methyl-3-[(E)-2-[4-(2-phenylethynyl)phenyl]prop-1-enyl]hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 145465512 |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (3Z)-4-methyl-3-[(E)-2-[4-(2-phenylethynyl)phenyl]prop-1-enyl]hexa-3,5-dien-2-one |
| SMILES | C=C/C(C)=C(/C=C(\C)c1ccc(C#Cc2ccccc2)cc1)C(C)=O |
| InChI | InChI=1S/C24H22O/c1-5-18(2)24(20(4)25)17-19(3)23-15-13-22(14-16-23)12-11-21-9-7-6-8-10-21/h5-10,13-17H,1H2,2-4H3/b19-17+,24-18- |
| InChIKey | PGAJWYIIYJQZNC-NRMSWXAWSA-N |
| XLogP | 5.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|