C24H16OS — CID 59029892
S-[4-[2-[4-(2-phenylethynyl)phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 59029892) has the molecular formula C24H16OS and a molecular weight of 352.46 g/mol. Its IUPAC name is S-[4-[2-[4-(2-phenylethynyl)phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[4-(2-phenylethynyl)phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 59029892 |
| Molecular Formula | C24H16OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | S-[4-[2-[4-(2-phenylethynyl)phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(C#Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H16OS/c1-19(25)26-24-17-15-23(16-18-24)14-13-22-11-9-21(10-12-22)8-7-20-5-3-2-4-6-20/h2-6,9-12,15-18H,1H3 |
| InChIKey | ZWLJTQTZLWBSFY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|