C20H16FeOS-6 — CID 87643577
S-[4-(2-cyclopenta-2,4-dien-1-ylethynyl)phenyl] ethanethioate;cyclopentane;iron (PubChem CID 87643577) has the molecular formula C20H16FeOS-6 and a molecular weight of 360.26 g/mol. Its IUPAC name is S-[4-(2-cyclopenta-2,4-dien-1-ylethynyl)phenyl] ethanethioate;cyclopentane;iron.
| Compound Name | S-[4-(2-cyclopenta-2,4-dien-1-ylethynyl)phenyl] ethanethioate;cyclopentane;iron |
|---|---|
| PubChem CID | 87643577 |
| Molecular Formula | C20H16FeOS-6 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | S-[4-(2-cyclopenta-2,4-dien-1-ylethynyl)phenyl] ethanethioate;cyclopentane;iron |
| SMILES | CC(=O)Sc1ccc(C#C[c-]2cccc2)cc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C15H11OS.C5H5.Fe/c1-12(16)17-15-10-8-14(9-11-15)7-6-13-4-2-3-5-13;1-2-4-5-3-1;/h2-5,8-11H,1H3;1-5H;/q-1;-5; |
| InChIKey | GGJOFZFLGBIQCU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|