C36H24FeOS+2 — CID 10951857
CID 10951857 (PubChem CID 10951857) has the molecular formula C36H24FeOS+2 and a molecular weight of 560.50 g/mol.
| Compound Name | CID 10951857 |
|---|---|
| PubChem CID | 10951857 |
| Molecular Formula | C36H24FeOS+2 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | — |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(C#Cc3ccc(C#C[C]4[CH][CH][CH][CH]4)cc3)cc2)cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C31H19OS.C5H5.Fe/c1-24(32)33-31-22-20-30(21-23-31)19-18-29-16-14-28(15-17-29)13-12-27-10-8-26(9-11-27)7-6-25-4-2-3-5-25;1-2-4-5-3-1;/h2-5,8-11,14-17,20-23H,1H3;1-5H;/q;;+2 |
| InChIKey | JWGHMJIPSQLQDE-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|