C24H15NO3S — CID 10135429
S-[4-[2-[3-nitro-4-(2-phenylethynyl)phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 10135429) has the molecular formula C24H15NO3S and a molecular weight of 397.46 g/mol. Its IUPAC name is S-[4-[2-[3-nitro-4-(2-phenylethynyl)phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[3-nitro-4-(2-phenylethynyl)phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 10135429 |
| Molecular Formula | C24H15NO3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | S-[4-[2-[3-nitro-4-(2-phenylethynyl)phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(C#Cc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H15NO3S/c1-18(26)29-23-15-11-20(12-16-23)7-8-21-10-14-22(24(17-21)25(27)28)13-9-19-5-3-2-4-6-19/h2-6,10-12,14-17H,1H3 |
| InChIKey | KHIIGDVUYLBTPF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|