C50H30O2S2 — CID 101348270
S-[4-[2-[4-[2-[8-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]phenyl]ethynyl]anthracen-1-yl]ethynyl]phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 101348270) has the molecular formula C50H30O2S2 and a molecular weight of 726.92 g/mol. Its IUPAC name is S-[4-[2-[4-[2-[8-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]phenyl]ethynyl]anthracen-1-yl]ethynyl]phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[4-[2-[8-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]phenyl]ethynyl]anthracen-1-yl]ethynyl]phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 101348270 |
| Molecular Formula | C50H30O2S2 |
| Molecular Weight | 726.92 g/mol |
| Exact Mass | 726.17 |
| IUPAC Name | S-[4-[2-[4-[2-[8-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]phenyl]ethynyl]anthracen-1-yl]ethynyl]phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(C#Cc3cccc4cc5cccc(C#Cc6ccc(C#Cc7ccc(SC(C)=O)cc7)cc6)c5cc34)cc2)cc1 |
| InChI | InChI=1S/C50H30O2S2/c1-35(51)53-47-29-23-41(24-30-47)19-13-37-9-15-39(16-10-37)21-27-43-5-3-7-45-33-46-8-4-6-44(50(46)34-49(43)45)28-22-40-17-11-38(12-18-40)14-20-42-25-31-48(32-26-42)54-36(2)52/h3-12,15-18,23-26,29-34H,1-2H3 |
| InChIKey | ZWMWRNIBTVYMTB-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.92 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|