C20H14 — CID 122211067
1,8-bis(prop-1-ynyl)anthracene (PubChem CID 122211067) has the molecular formula C20H14 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,8-bis(prop-1-ynyl)anthracene.
| Compound Name | 1,8-bis(prop-1-ynyl)anthracene |
|---|---|
| PubChem CID | 122211067 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1,8-bis(prop-1-ynyl)anthracene |
| SMILES | CC#Cc1cccc2cc3cccc(C#CC)c3cc12 |
| InChI | InChI=1S/C20H14/c1-3-7-15-9-5-11-17-13-18-12-6-10-16(8-4-2)20(18)14-19(15)17/h5-6,9-14H,1-2H3 |
| InChIKey | SNZISOOTEBKNJI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|