C64H66Si2 — CID 101376385
tri(propan-2-yl)-[2-[8-[8-[8-[2-tri(propan-2-yl)silylethynyl]anthracen-1-yl]anthracen-1-yl]anthracen-1-yl]ethynyl]silane (PubChem CID 101376385) has the molecular formula C64H66Si2 and a molecular weight of 891.40 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[8-[8-[8-[2-tri(propan-2-yl)silylethynyl]anthracen-1-yl]anthracen-1-yl]anthracen-1-yl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[8-[8-[8-[2-tri(propan-2-yl)silylethynyl]anthracen-1-yl]anthracen-1-yl]anthracen-1-yl]ethynyl]silane |
|---|---|
| PubChem CID | 101376385 |
| Molecular Formula | C64H66Si2 |
| Molecular Weight | 891.40 g/mol |
| Exact Mass | 890.47 |
| IUPAC Name | tri(propan-2-yl)-[2-[8-[8-[8-[2-tri(propan-2-yl)silylethynyl]anthracen-1-yl]anthracen-1-yl]anthracen-1-yl]ethynyl]silane |
| SMILES | CC(C)[Si](C#Cc1cccc2cc3cccc(-c4cccc5cc6cccc(-c7cccc8cc9cccc(C#C[Si](C(C)C)(C(C)C)C(C)C)c9cc78)c6cc45)c3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C64H66Si2/c1-41(2)65(42(3)4,43(5)6)33-31-47-19-13-21-49-35-51-23-15-27-55(61(51)38-59(47)49)57-29-17-25-53-37-54-26-18-30-58(64(54)40-63(53)57)56-28-16-24-52-36-50-22-14-20-48(60(50)39-62(52)56)32-34-66(44(7)8,45(9)10)46(11)12/h13-30,35-46H,1-12H3 |
| InChIKey | ORXSWRNMEAKTQM-UHFFFAOYSA-N |
| XLogP | 19.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.40 |
| LogP ≤ 5 | 19.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|