C38H48N6Si2 — CID 102459339
tri(propan-2-yl)-[2-[20-[2-tri(propan-2-yl)silylethynyl]-2,4,11,13,15,22-hexazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaen-6-yl]ethynyl]silane (PubChem CID 102459339) has the molecular formula C38H48N6Si2 and a molecular weight of 645.02 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[20-[2-tri(propan-2-yl)silylethynyl]-2,4,11,13,15,22-hexazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaen-6-yl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[20-[2-tri(propan-2-yl)silylethynyl]-2,4,11,13,15,22-hexazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaen-6-yl]ethynyl]silane |
|---|---|
| PubChem CID | 102459339 |
| Molecular Formula | C38H48N6Si2 |
| Molecular Weight | 645.02 g/mol |
| Exact Mass | 644.35 |
| IUPAC Name | tri(propan-2-yl)-[2-[20-[2-tri(propan-2-yl)silylethynyl]-2,4,11,13,15,22-hexazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaen-6-yl]ethynyl]silane |
| SMILES | CC(C)[Si](C#Cc1cccc2nc3nc4nc5cccc(C#C[Si](C(C)C)(C(C)C)C(C)C)c5nc4nc3nc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H48N6Si2/c1-23(2)45(24(3)4,25(5)6)21-19-29-15-13-17-31-33(29)41-37-35(39-31)43-36-38(44-37)42-34-30(16-14-18-32(34)40-36)20-22-46(26(7)8,27(9)10)28(11)12/h13-18,23-28H,1-12H3 |
| InChIKey | GDBPEBYJLSDXDJ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.02 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|