C17H26ClNSi — CID 123985583
2-chloro-6-[2-tri(propan-2-yl)silylethynyl]aniline (PubChem CID 123985583) has the molecular formula C17H26ClNSi and a molecular weight of 307.94 g/mol. Its IUPAC name is 2-chloro-6-[2-tri(propan-2-yl)silylethynyl]aniline.
| Compound Name | 2-chloro-6-[2-tri(propan-2-yl)silylethynyl]aniline |
|---|---|
| PubChem CID | 123985583 |
| Molecular Formula | C17H26ClNSi |
| Molecular Weight | 307.94 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-chloro-6-[2-tri(propan-2-yl)silylethynyl]aniline |
| SMILES | CC(C)[Si](C#Cc1cccc(Cl)c1N)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H26ClNSi/c1-12(2)20(13(3)4,14(5)6)11-10-15-8-7-9-16(18)17(15)19/h7-9,12-14H,19H2,1-6H3 |
| InChIKey | UWDOZDHYJARZCX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.94 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|