C44H50O2Si2 — CID 102442250
9,18-bis[2-tri(propan-2-yl)silylethynyl]hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(20),2(11),3(8),4,6,9,13,15,17(21),18-decaene-12,22-dione (PubChem CID 102442250) has the molecular formula C44H50O2Si2 and a molecular weight of 667.05 g/mol. Its IUPAC name is 9,18-bis[2-tri(propan-2-yl)silylethynyl]hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(20),2(11),3(8),4,6,9,13,15,17(21),18-decaene-12,22-dione.
| Compound Name | 9,18-bis[2-tri(propan-2-yl)silylethynyl]hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(20),2(11),3(8),4,6,9,13,15,17(21),18-decaene-12,22-dione |
|---|---|
| PubChem CID | 102442250 |
| Molecular Formula | C44H50O2Si2 |
| Molecular Weight | 667.05 g/mol |
| Exact Mass | 666.33 |
| IUPAC Name | 9,18-bis[2-tri(propan-2-yl)silylethynyl]hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(20),2(11),3(8),4,6,9,13,15,17(21),18-decaene-12,22-dione |
| SMILES | CC(C)[Si](C#Cc1cc2c3c4c1cccc4c(=O)c1cc(C#C[Si](C(C)C)(C(C)C)C(C)C)c4cccc(c2=O)c4c1-3)(C(C)C)C(C)C |
| InChI | InChI=1S/C44H50O2Si2/c1-25(2)47(26(3)4,27(5)6)21-19-31-23-37-41-39-33(31)15-13-17-35(39)44(46)38-24-32(20-22-48(28(7)8,29(9)10)30(11)12)34-16-14-18-36(43(37)45)40(34)42(38)41/h13-18,23-30H,1-12H3 |
| InChIKey | VIWMDIXBPWIWPO-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.05 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|