C22H31BO3Si — CID 166095774
[4-methoxy-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]boronic acid (PubChem CID 166095774) has the molecular formula C22H31BO3Si and a molecular weight of 382.39 g/mol. Its IUPAC name is [4-methoxy-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]boronic acid.
| Compound Name | [4-methoxy-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]boronic acid |
|---|---|
| PubChem CID | 166095774 |
| Molecular Formula | C22H31BO3Si |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [4-methoxy-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]boronic acid |
| SMILES | COc1ccc(B(O)O)c2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cccc12 |
| InChI | InChI=1S/C22H31BO3Si/c1-15(2)27(16(3)4,17(5)6)14-13-18-9-8-10-19-21(26-7)12-11-20(22(18)19)23(24)25/h8-12,15-17,24-25H,1-7H3 |
| InChIKey | MWJLSWVNCUEXRK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|