C33H50OSi2 — CID 169049968
2-[1-methoxy-6-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 169049968) has the molecular formula C33H50OSi2 and a molecular weight of 518.93 g/mol. Its IUPAC name is 2-[1-methoxy-6-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[1-methoxy-6-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 169049968 |
| Molecular Formula | C33H50OSi2 |
| Molecular Weight | 518.93 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | 2-[1-methoxy-6-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | COc1c(C#C[Si](C(C)C)(C(C)C)C(C)C)ccc2cc(C#C[Si](C(C)C)(C(C)C)C(C)C)ccc12 |
| InChI | InChI=1S/C33H50OSi2/c1-23(2)35(24(3)4,25(5)6)20-18-29-14-17-32-31(22-29)16-15-30(33(32)34-13)19-21-36(26(7)8,27(9)10)28(11)12/h14-17,22-28H,1-13H3 |
| InChIKey | XEFRLKDROPLSHV-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.93 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|