C32H48Si2 — CID 169050439
tri(propan-2-yl)-[2-[5-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]ethynyl]silane (PubChem CID 169050439) has the molecular formula C32H48Si2 and a molecular weight of 488.91 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[5-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[5-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]ethynyl]silane |
|---|---|
| PubChem CID | 169050439 |
| Molecular Formula | C32H48Si2 |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | tri(propan-2-yl)-[2-[5-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]ethynyl]silane |
| SMILES | CC(C)[Si](C#Cc1cccc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cccc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H48Si2/c1-23(2)33(24(3)4,25(5)6)21-19-29-15-13-18-32-30(16-14-17-31(29)32)20-22-34(26(7)8,27(9)10)28(11)12/h13-18,23-28H,1-12H3 |
| InChIKey | UFPVGJQFNQOMEW-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|