C32H50N2Si2 — CID 73211982
1,4-bis[2-tri(propan-2-yl)silylethynyl]naphthalene-2,3-diamine (PubChem CID 73211982) has the molecular formula C32H50N2Si2 and a molecular weight of 518.94 g/mol. Its IUPAC name is 1,4-bis[2-tri(propan-2-yl)silylethynyl]naphthalene-2,3-diamine.
| Compound Name | 1,4-bis[2-tri(propan-2-yl)silylethynyl]naphthalene-2,3-diamine |
|---|---|
| PubChem CID | 73211982 |
| Molecular Formula | C32H50N2Si2 |
| Molecular Weight | 518.94 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | 1,4-bis[2-tri(propan-2-yl)silylethynyl]naphthalene-2,3-diamine |
| SMILES | CC(C)[Si](C#Cc1c(N)c(N)c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2ccccc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H50N2Si2/c1-21(2)35(22(3)4,23(5)6)19-17-29-27-15-13-14-16-28(27)30(32(34)31(29)33)18-20-36(24(7)8,25(9)10)26(11)12/h13-16,21-26H,33-34H2,1-12H3 |
| InChIKey | NZIWEZJZPHIFJP-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.94 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|