C35H34Si — CID 102307090
2-(13-ethynylpentacen-6-yl)ethynyl-tri(propan-2-yl)silane (PubChem CID 102307090) has the molecular formula C35H34Si and a molecular weight of 482.74 g/mol. Its IUPAC name is 2-(13-ethynylpentacen-6-yl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(13-ethynylpentacen-6-yl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102307090 |
| Molecular Formula | C35H34Si |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 2-(13-ethynylpentacen-6-yl)ethynyl-tri(propan-2-yl)silane |
| SMILES | C#Cc1c2cc3ccccc3cc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C35H34Si/c1-8-30-32-19-26-13-9-11-15-28(26)21-34(32)31(17-18-36(23(2)3,24(4)5)25(6)7)35-22-29-16-12-10-14-27(29)20-33(30)35/h1,9-16,19-25H,2-7H3 |
| InChIKey | LNXMQQWTRFJECI-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|