C54H86Si4 — CID 10653117
2-[2,3-diethynyl-4,5,6-tris[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 10653117) has the molecular formula C54H86Si4 and a molecular weight of 847.63 g/mol. Its IUPAC name is 2-[2,3-diethynyl-4,5,6-tris[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[2,3-diethynyl-4,5,6-tris[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10653117 |
| Molecular Formula | C54H86Si4 |
| Molecular Weight | 847.63 g/mol |
| Exact Mass | 846.58 |
| IUPAC Name | 2-[2,3-diethynyl-4,5,6-tris[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | C#Cc1c(C#C)c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(C#C[Si](C(C)C)(C(C)C)C(C)C)c1C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C54H86Si4/c1-27-49-50(28-2)52(30-34-56(40(9)10,41(11)12)42(13)14)54(32-36-58(46(21)22,47(23)24)48(25)26)53(31-35-57(43(15)16,44(17)18)45(19)20)51(49)29-33-55(37(3)4,38(5)6)39(7)8/h1-2,37-48H,3-26H3 |
| InChIKey | SRRWMPIPSOESOS-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.63 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|