C49H84OSi4 — CID 11136543
2,3,4,5-tetrakis[2-tri(propan-2-yl)silylethynyl]cyclopenta-2,4-dien-1-one (PubChem CID 11136543) has the molecular formula C49H84OSi4 and a molecular weight of 801.55 g/mol. Its IUPAC name is 2,3,4,5-tetrakis[2-tri(propan-2-yl)silylethynyl]cyclopenta-2,4-dien-1-one.
| Compound Name | 2,3,4,5-tetrakis[2-tri(propan-2-yl)silylethynyl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 11136543 |
| Molecular Formula | C49H84OSi4 |
| Molecular Weight | 801.55 g/mol |
| Exact Mass | 800.56 |
| IUPAC Name | 2,3,4,5-tetrakis[2-tri(propan-2-yl)silylethynyl]cyclopenta-2,4-dien-1-one |
| SMILES | CC(C)[Si](C#CC1=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C49H84OSi4/c1-33(2)51(34(3)4,35(5)6)29-25-45-46(26-30-52(36(7)8,37(9)10)38(11)12)48(28-32-54(42(19)20,43(21)22)44(23)24)49(50)47(45)27-31-53(39(13)14,40(15)16)41(17)18/h33-44H,1-24H3 |
| InChIKey | YDZDRNYHTGRWME-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.55 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|