C51H58Br2OSi2 — CID 134977261
2,5-bis(4-bromophenyl)-3,4-bis[4-[2-tri(propan-2-yl)silylethynyl]phenyl]cyclopenta-2,4-dien-1-one (PubChem CID 134977261) has the molecular formula C51H58Br2OSi2 and a molecular weight of 903.00 g/mol. Its IUPAC name is 2,5-bis(4-bromophenyl)-3,4-bis[4-[2-tri(propan-2-yl)silylethynyl]phenyl]cyclopenta-2,4-dien-1-one.
| Compound Name | 2,5-bis(4-bromophenyl)-3,4-bis[4-[2-tri(propan-2-yl)silylethynyl]phenyl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 134977261 |
| Molecular Formula | C51H58Br2OSi2 |
| Molecular Weight | 903.00 g/mol |
| Exact Mass | 900.24 |
| IUPAC Name | 2,5-bis(4-bromophenyl)-3,4-bis[4-[2-tri(propan-2-yl)silylethynyl]phenyl]cyclopenta-2,4-dien-1-one |
| SMILES | CC(C)[Si](C#Cc1ccc(C2=C(c3ccc(Br)cc3)C(=O)C(c3ccc(Br)cc3)=C2c2ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc2)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C51H58Br2OSi2/c1-33(2)55(34(3)4,35(5)6)31-29-39-13-17-41(18-14-39)47-48(42-19-15-40(16-20-42)30-32-56(36(7)8,37(9)10)38(11)12)50(44-23-27-46(53)28-24-44)51(54)49(47)43-21-25-45(52)26-22-43/h13-28,33-38H,1-12H3 |
| InChIKey | DIEBWYXAOMUGOC-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.00 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|