C25H33BrO2Si — CID 129406581
(S)-(5-bromo-2-methoxyphenyl)-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]methanol (PubChem CID 129406581) has the molecular formula C25H33BrO2Si and a molecular weight of 473.53 g/mol. Its IUPAC name is (S)-(5-bromo-2-methoxyphenyl)-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]methanol.
| Compound Name | (S)-(5-bromo-2-methoxyphenyl)-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]methanol |
|---|---|
| PubChem CID | 129406581 |
| Molecular Formula | C25H33BrO2Si |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (S)-(5-bromo-2-methoxyphenyl)-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]methanol |
| SMILES | COc1ccc(Br)cc1[C@@H](O)c1ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C25H33BrO2Si/c1-17(2)29(18(3)4,19(5)6)15-14-20-8-10-21(11-9-20)25(27)23-16-22(26)12-13-24(23)28-7/h8-13,16-19,25,27H,1-7H3/t25-/m0/s1 |
| InChIKey | RGJXEQRYRPYKGS-VWLOTQADSA-N |
| XLogP | 7.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|