C41H37BrSi — CID 102596944
2-[13-[2-(4-bromophenyl)ethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 102596944) has the molecular formula C41H37BrSi and a molecular weight of 637.74 g/mol. Its IUPAC name is 2-[13-[2-(4-bromophenyl)ethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[13-[2-(4-bromophenyl)ethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102596944 |
| Molecular Formula | C41H37BrSi |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | 2-[13-[2-(4-bromophenyl)ethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1c2cc3ccccc3cc2c(C#Cc2ccc(Br)cc2)c2cc3ccccc3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C41H37BrSi/c1-27(2)43(28(3)4,29(5)6)22-21-37-40-25-33-13-9-7-11-31(33)23-38(40)36(20-17-30-15-18-35(42)19-16-30)39-24-32-12-8-10-14-34(32)26-41(37)39/h7-16,18-19,23-29H,1-6H3 |
| InChIKey | SGBNNKNGHVDQNL-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|