C33H34Si — CID 141495098
2-pentacen-6-ylethynyl-tri(propan-2-yl)silane (PubChem CID 141495098) has the molecular formula C33H34Si and a molecular weight of 458.72 g/mol. Its IUPAC name is 2-pentacen-6-ylethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-pentacen-6-ylethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 141495098 |
| Molecular Formula | C33H34Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-pentacen-6-ylethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1c2cc3ccccc3cc2cc2cc3ccccc3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H34Si/c1-22(2)34(23(3)4,24(5)6)16-15-31-32-20-27-13-9-7-11-25(27)17-29(32)19-30-18-26-12-8-10-14-28(26)21-33(30)31/h7-14,17-24H,1-6H3 |
| InChIKey | TYMIFCXSAJCWTA-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|