C44H53NO2Si2 — CID 140861255
2-[2-nitro-13-[2-tri(propan-2-yl)silylethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 140861255) has the molecular formula C44H53NO2Si2 and a molecular weight of 684.09 g/mol. Its IUPAC name is 2-[2-nitro-13-[2-tri(propan-2-yl)silylethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[2-nitro-13-[2-tri(propan-2-yl)silylethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 140861255 |
| Molecular Formula | C44H53NO2Si2 |
| Molecular Weight | 684.09 g/mol |
| Exact Mass | 683.36 |
| IUPAC Name | 2-[2-nitro-13-[2-tri(propan-2-yl)silylethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1c2cc3ccccc3cc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc3cc([N+](=O)[O-])ccc3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C44H53NO2Si2/c1-28(2)48(29(3)4,30(5)6)21-19-39-41-24-34-15-13-14-16-35(34)25-42(41)40(20-22-49(31(7)8,32(9)10)33(11)12)44-27-37-23-38(45(46)47)18-17-36(37)26-43(39)44/h13-18,23-33H,1-12H3 |
| InChIKey | WKVADGVARXKVMS-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.09 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|