C42H40OSi — CID 102596941
2-[13-[2-(4-methoxyphenyl)ethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 102596941) has the molecular formula C42H40OSi and a molecular weight of 588.87 g/mol. Its IUPAC name is 2-[13-[2-(4-methoxyphenyl)ethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[13-[2-(4-methoxyphenyl)ethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102596941 |
| Molecular Formula | C42H40OSi |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 2-[13-[2-(4-methoxyphenyl)ethynyl]pentacen-6-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | COc1ccc(C#Cc2c3cc4ccccc4cc3c(C#C[Si](C(C)C)(C(C)C)C(C)C)c3cc4ccccc4cc23)cc1 |
| InChI | InChI=1S/C42H40OSi/c1-28(2)44(29(3)4,30(5)6)23-22-38-41-26-34-14-10-8-12-32(34)24-39(41)37(21-18-31-16-19-36(43-7)20-17-31)40-25-33-13-9-11-15-35(33)27-42(38)40/h8-17,19-20,24-30H,1-7H3 |
| InChIKey | NYSITCHLBZKNDT-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|