C23H32O2Si — CID 169050369
2-(2,6-dimethoxynaphthalen-1-yl)ethynyl-tri(propan-2-yl)silane (PubChem CID 169050369) has the molecular formula C23H32O2Si and a molecular weight of 368.59 g/mol. Its IUPAC name is 2-(2,6-dimethoxynaphthalen-1-yl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(2,6-dimethoxynaphthalen-1-yl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 169050369 |
| Molecular Formula | C23H32O2Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-(2,6-dimethoxynaphthalen-1-yl)ethynyl-tri(propan-2-yl)silane |
| SMILES | COc1ccc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(OC)ccc2c1 |
| InChI | InChI=1S/C23H32O2Si/c1-16(2)26(17(3)4,18(5)6)14-13-22-21-11-10-20(24-7)15-19(21)9-12-23(22)25-8/h9-12,15-18H,1-8H3 |
| InChIKey | JEOVNIFFJMHASA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|