C13H14O2 — CID 68950467
2,6-dimethoxy-1-methylnaphthalene (PubChem CID 68950467) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2,6-dimethoxy-1-methylnaphthalene.
| Compound Name | 2,6-dimethoxy-1-methylnaphthalene |
|---|---|
| PubChem CID | 68950467 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2,6-dimethoxy-1-methylnaphthalene |
| SMILES | COc1ccc2c(C)c(OC)ccc2c1 |
| InChI | InChI=1S/C13H14O2/c1-9-12-6-5-11(14-2)8-10(12)4-7-13(9)15-3/h4-8H,1-3H3 |
| InChIKey | ZOGZUNRZCCDFQP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |