C18H18O4 — CID 11437978
2,3,4,7-tetramethoxyphenanthrene (PubChem CID 11437978) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2,3,4,7-tetramethoxyphenanthrene.
| Compound Name | 2,3,4,7-tetramethoxyphenanthrene |
|---|---|
| PubChem CID | 11437978 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2,3,4,7-tetramethoxyphenanthrene |
| SMILES | COc1ccc2c(ccc3cc(OC)c(OC)c(OC)c32)c1 |
| InChI | InChI=1S/C18H18O4/c1-19-13-7-8-14-11(9-13)5-6-12-10-15(20-2)17(21-3)18(22-4)16(12)14/h5-10H,1-4H3 |
| InChIKey | SZWNNHPMXYWRRE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|